C20H14ClN3O2S — CID 41063252
(8R)-2-(4-chlorophenyl)-8-thiophen-2-yl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione (PubChem CID 41063252) has the molecular formula C20H14ClN3O2S and a molecular weight of 395.87 g/mol. Its IUPAC name is (8R)-2-(4-chlorophenyl)-8-thiophen-2-yl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione.
| Compound Name | (8R)-2-(4-chlorophenyl)-8-thiophen-2-yl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 41063252 |
| Molecular Formula | C20H14ClN3O2S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | (8R)-2-(4-chlorophenyl)-8-thiophen-2-yl-3,7,8,9-tetrahydropyrazolo[3,4-c]isoquinoline-1,6-dione |
| SMILES | O=C1C[C@H](c2cccs2)Cc2c1cnc1[nH]n(-c3ccc(Cl)cc3)c(=O)c21 |
| InChI | InChI=1S/C20H14ClN3O2S/c21-12-3-5-13(6-4-12)24-20(26)18-14-8-11(17-2-1-7-27-17)9-16(25)15(14)10-22-19(18)23-24/h1-7,10-11H,8-9H2,(H,22,23)/t11-/m1/s1 |
| InChIKey | DGURBZBVUSCERV-LLVKDONJSA-N |
| XLogP | 4.34 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|