C27H21N3O2 — CID 132545093
11-(4-methoxyphenyl)-14-phenyl-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaen-13-one (PubChem CID 132545093) has the molecular formula C27H21N3O2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-14-phenyl-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaen-13-one.
| Compound Name | 11-(4-methoxyphenyl)-14-phenyl-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaen-13-one |
|---|---|
| PubChem CID | 132545093 |
| Molecular Formula | C27H21N3O2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 11-(4-methoxyphenyl)-14-phenyl-14,15,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16)-hexaen-13-one |
| SMILES | COc1ccc(-c2c3c(nc4[nH]n(-c5ccccc5)c(=O)c24)-c2ccccc2CC3)cc1 |
| InChI | InChI=1S/C27H21N3O2/c1-32-20-14-11-18(12-15-20)23-22-16-13-17-7-5-6-10-21(17)25(22)28-26-24(23)27(31)30(29-26)19-8-3-2-4-9-19/h2-12,14-15H,13,16H2,1H3,(H,28,29) |
| InChIKey | MVXRAKGPHJURHI-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|