C24H30N6O4 — CID 135903191
25-hydroxy-7-methoxy-14-propan-2-yl-9-oxa-3,14,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-13-one (PubChem CID 135903191) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is 25-hydroxy-7-methoxy-14-propan-2-yl-9-oxa-3,14,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-13-one.
| Compound Name | 25-hydroxy-7-methoxy-14-propan-2-yl-9-oxa-3,14,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-13-one |
|---|---|
| PubChem CID | 135903191 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | 25-hydroxy-7-methoxy-14-propan-2-yl-9-oxa-3,14,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-13-one |
| SMILES | COc1ccc2cc1OCCCC(=O)N(C(C)C)CCCNc1ncnc3[nH]c(O)c(c13)/C=N\2 |
| InChI | InChI=1S/C24H30N6O4/c1-15(2)30-10-5-9-25-22-21-17(24(32)29-23(21)28-14-27-22)13-26-16-7-8-18(33-3)19(12-16)34-11-4-6-20(30)31/h7-8,12-15,32H,4-6,9-11H2,1-3H3,(H2,25,27,28,29)/b26-13- |
| InChIKey | PPYORDGUINTKJP-ZMFRSBBQSA-N |
| XLogP | 3.63 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |