C25H31N7O4 — CID 135903147
25-hydroxy-15-methyl-7-morpholin-4-yl-9-oxa-3,15,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-14-one (PubChem CID 135903147) has the molecular formula C25H31N7O4 and a molecular weight of 493.57 g/mol. Its IUPAC name is 25-hydroxy-15-methyl-7-morpholin-4-yl-9-oxa-3,15,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-14-one.
| Compound Name | 25-hydroxy-15-methyl-7-morpholin-4-yl-9-oxa-3,15,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-14-one |
|---|---|
| PubChem CID | 135903147 |
| Molecular Formula | C25H31N7O4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 25-hydroxy-15-methyl-7-morpholin-4-yl-9-oxa-3,15,18,20,22,24-hexazatetracyclo[17.6.1.14,8.023,26]heptacosa-1(25),2,4(27),5,7,19,21,23(26)-octaen-14-one |
| SMILES | CN1CCNc2ncnc3[nH]c(O)c(c23)/C=N\c2ccc(N3CCOCC3)c(c2)OCCCCC1=O |
| InChI | InChI=1S/C25H31N7O4/c1-31-8-7-26-23-22-18(25(34)30-24(22)29-16-28-23)15-27-17-5-6-19(32-9-12-35-13-10-32)20(14-17)36-11-3-2-4-21(31)33/h5-6,14-16,34H,2-4,7-13H2,1H3,(H2,26,28,29,30)/b27-15- |
| InChIKey | KYRGLZJVKQGEAR-DICXZTSXSA-N |
| XLogP | 2.68 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|