C27H37N7O3 — CID 123179770
7-methoxy-10,17,21-trimethyl-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22,24,26(29)-heptaene-16,28-dione (PubChem CID 123179770) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is 7-methoxy-10,17,21-trimethyl-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22,24,26(29)-heptaene-16,28-dione.
| Compound Name | 7-methoxy-10,17,21-trimethyl-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22,24,26(29)-heptaene-16,28-dione |
|---|---|
| PubChem CID | 123179770 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 7-methoxy-10,17,21-trimethyl-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22,24,26(29)-heptaene-16,28-dione |
| SMILES | COc1ccc2cc1CN(C)CCCCCC(=O)N(C)CCCN(C)c1ncnc3c1C(/C=N/2)C(=O)N3 |
| InChI | InChI=1S/C27H37N7O3/c1-32-12-7-5-6-9-23(35)33(2)13-8-14-34(3)26-24-21(27(36)31-25(24)29-18-30-26)16-28-20-10-11-22(37-4)19(15-20)17-32/h10-11,15-16,18,21H,5-9,12-14,17H2,1-4H3,(H,29,30,31,36)/b28-16+ |
| InChIKey | NAAAOBMPPAXTBZ-LQKURTRISA-N |
| XLogP | 3.21 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |