C23H20N6O3 — CID 91321628
17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,12(29),13,15,18,20,25-decaene-8,23-dione (PubChem CID 91321628) has the molecular formula C23H20N6O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is 17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,12(29),13,15,18,20,25-decaene-8,23-dione.
| Compound Name | 17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,12(29),13,15,18,20,25-decaene-8,23-dione |
|---|---|
| PubChem CID | 91321628 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 17-oxa-1,3,5,7,11,24-hexazapentacyclo[22.2.2.12,6.112,16.09,30]triaconta-2,4,6(30),10,12(29),13,15,18,20,25-decaene-8,23-dione |
| SMILES | O=C1Nc2ncnc3c2C1/C=N/c1cccc(c1)OC=CC=CCC(=O)N1C=CN3CC1 |
| InChI | InChI=1S/C23H20N6O3/c30-19-7-2-1-3-12-32-17-6-4-5-16(13-17)24-14-18-20-21(27-23(18)31)25-15-26-22(20)29-10-8-28(19)9-11-29/h1-6,8,10,12-15,18H,7,9,11H2,(H,25,26,27,31)/b2-1?,12-3?,24-14+ |
| InChIKey | VPCKJURABBFXDA-FZSOEBBJSA-N |
| XLogP | 2.89 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |