C22H27N7O2 — CID 123914852
10,15-dimethyl-3,10,15,18,20,22,24-heptazatetracyclo[17.6.1.14,8.023,26]heptacosa-2,4,6,8(27),19(26),20,22-heptaene-14,25-dione (PubChem CID 123914852) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is 10,15-dimethyl-3,10,15,18,20,22,24-heptazatetracyclo[17.6.1.14,8.023,26]heptacosa-2,4,6,8(27),19(26),20,22-heptaene-14,25-dione.
| Compound Name | 10,15-dimethyl-3,10,15,18,20,22,24-heptazatetracyclo[17.6.1.14,8.023,26]heptacosa-2,4,6,8(27),19(26),20,22-heptaene-14,25-dione |
|---|---|
| PubChem CID | 123914852 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 10,15-dimethyl-3,10,15,18,20,22,24-heptazatetracyclo[17.6.1.14,8.023,26]heptacosa-2,4,6,8(27),19(26),20,22-heptaene-14,25-dione |
| SMILES | CN1CCCC(=O)N(C)CCNc2ncnc3c2C(/C=N\c2cccc(c2)C1)C(=O)N3 |
| InChI | InChI=1S/C22H27N7O2/c1-28-9-4-7-18(30)29(2)10-8-23-20-19-17(22(31)27-21(19)26-14-25-20)12-24-16-6-3-5-15(11-16)13-28/h3,5-6,11-12,14,17H,4,7-10,13H2,1-2H3,(H2,23,25,26,27,31)/b24-12- |
| InChIKey | YGIDDERWOSCEKU-MSXFZWOLSA-N |
| XLogP | 2.01 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |