C21H26N6O2 — CID 59442241
13,16-dimethyl-8-oxa-2,13,16,20,22,24-hexazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(24),3(26),4,6,18,21(25),22-heptaen-12-one (PubChem CID 59442241) has the molecular formula C21H26N6O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is 13,16-dimethyl-8-oxa-2,13,16,20,22,24-hexazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(24),3(26),4,6,18,21(25),22-heptaen-12-one.
| Compound Name | 13,16-dimethyl-8-oxa-2,13,16,20,22,24-hexazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(24),3(26),4,6,18,21(25),22-heptaen-12-one |
|---|---|
| PubChem CID | 59442241 |
| Molecular Formula | C21H26N6O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 13,16-dimethyl-8-oxa-2,13,16,20,22,24-hexazatetracyclo[16.6.1.13,7.021,25]hexacosa-1(24),3(26),4,6,18,21(25),22-heptaen-12-one |
| SMILES | CN1CCN(C)C(=O)CCCOc2cccc(c2)Nc2ncnc3[nH]cc(c23)C1 |
| InChI | InChI=1S/C21H26N6O2/c1-26-8-9-27(2)18(28)7-4-10-29-17-6-3-5-16(11-17)25-21-19-15(13-26)12-22-20(19)23-14-24-21/h3,5-6,11-12,14H,4,7-10,13H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | UGYJDBLAYHYLRR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |