C22H28N6O3 — CID 59442238
5,6-dimethoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),3(24),4,6,16,19(23),20-heptaen-11-one (PubChem CID 59442238) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 5,6-dimethoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),3(24),4,6,16,19(23),20-heptaen-11-one.
| Compound Name | 5,6-dimethoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),3(24),4,6,16,19(23),20-heptaen-11-one |
|---|---|
| PubChem CID | 59442238 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 5,6-dimethoxy-9,12-dimethyl-2,9,12,18,20,22-hexazatetracyclo[14.6.1.13,7.019,23]tetracosa-1(22),3(24),4,6,16,19(23),20-heptaen-11-one |
| SMILES | COc1cc2cc(c1OC)CN(C)CC(=O)N(C)CCCc1c[nH]c3ncnc(c13)N2 |
| InChI | InChI=1S/C22H28N6O3/c1-27-11-15-8-16(9-17(30-3)20(15)31-4)26-22-19-14(10-23-21(19)24-13-25-22)6-5-7-28(2)18(29)12-27/h8-10,13H,5-7,11-12H2,1-4H3,(H2,23,24,25,26) |
| InChIKey | DBJYPUXYNKXFJA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |