C26H34N6O3 — CID 59442391
11-cyclohexyl-6-methoxy-15-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,17,20(24),21-heptaen-10-one (PubChem CID 59442391) has the molecular formula C26H34N6O3 and a molecular weight of 478.60 g/mol. Its IUPAC name is 11-cyclohexyl-6-methoxy-15-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,17,20(24),21-heptaen-10-one.
| Compound Name | 11-cyclohexyl-6-methoxy-15-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,17,20(24),21-heptaen-10-one |
|---|---|
| PubChem CID | 59442391 |
| Molecular Formula | C26H34N6O3 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | 11-cyclohexyl-6-methoxy-15-methyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,17,20(24),21-heptaen-10-one |
| SMILES | COc1ccc2cc1OCC(=O)N(C1CCCCC1)CCCN(C)Cc1c[nH]c3ncnc(c13)N2 |
| InChI | InChI=1S/C26H34N6O3/c1-31-11-6-12-32(20-7-4-3-5-8-20)23(33)16-35-22-13-19(9-10-21(22)34-2)30-26-24-18(15-31)14-27-25(24)28-17-29-26/h9-10,13-14,17,20H,3-8,11-12,15-16H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | GMZRYHSVFNYXQS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |