C29H36N6O5 — CID 70862245
6-[2-(4-methoxyphenoxy)ethoxy]-11,15-dimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,20(24),21-hexaen-10-one (PubChem CID 70862245) has the molecular formula C29H36N6O5 and a molecular weight of 548.64 g/mol. Its IUPAC name is 6-[2-(4-methoxyphenoxy)ethoxy]-11,15-dimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,20(24),21-hexaen-10-one.
| Compound Name | 6-[2-(4-methoxyphenoxy)ethoxy]-11,15-dimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,20(24),21-hexaen-10-one |
|---|---|
| PubChem CID | 70862245 |
| Molecular Formula | C29H36N6O5 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 6-[2-(4-methoxyphenoxy)ethoxy]-11,15-dimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(23),3(25),4,6,20(24),21-hexaen-10-one |
| SMILES | COc1ccc(OCCOc2ccc3cc2OCC(=O)N(C)CCCN(C)CC2CNc4ncnc(c42)N3)cc1 |
| InChI | InChI=1S/C29H36N6O5/c1-34-11-4-12-35(2)26(36)18-40-25-15-21(33-29-27-20(17-34)16-30-28(27)31-19-32-29)5-10-24(25)39-14-13-38-23-8-6-22(37-3)7-9-23/h5-10,15,19-20H,4,11-14,16-18H2,1-3H3,(H2,30,31,32,33) |
| InChIKey | QEFHJXFKQSFSOK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 110.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|