C23H27N7O3 — CID 123438033
(16R)-18-methyl-9-oxa-3,12,18,21,23,25,27-heptazapentacyclo[20.6.1.14,8.012,16.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-11,28-dione (PubChem CID 123438033) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is (16R)-18-methyl-9-oxa-3,12,18,21,23,25,27-heptazapentacyclo[20.6.1.14,8.012,16.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-11,28-dione.
| Compound Name | (16R)-18-methyl-9-oxa-3,12,18,21,23,25,27-heptazapentacyclo[20.6.1.14,8.012,16.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-11,28-dione |
|---|---|
| PubChem CID | 123438033 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (16R)-18-methyl-9-oxa-3,12,18,21,23,25,27-heptazapentacyclo[20.6.1.14,8.012,16.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-11,28-dione |
| SMILES | CN1CCNc2ncnc3c2C(/C=N\c2cccc(c2)OCC(=O)N2CCC[C@@H]2C1)C(=O)N3 |
| InChI | InChI=1S/C23H27N7O3/c1-29-9-7-24-21-20-18(23(32)28-22(20)27-14-26-21)11-25-15-4-2-6-17(10-15)33-13-19(31)30-8-3-5-16(30)12-29/h2,4,6,10-11,14,16,18H,3,5,7-9,12-13H2,1H3,(H2,24,26,27,28,32)/b25-11-/t16-,18?/m1/s1 |
| InChIKey | UOTNOFNISAQDSP-DHTJNXSBSA-N |
| XLogP | 1.64 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |