C27H37N7O3 — CID 123431044
7-methoxy-10,18-dimethyl-3,10,18,22,24,26,28-heptazatetracyclo[21.6.1.14,8.027,30]hentriaconta-2,4(31),5,7,23(30),24,26-heptaene-17,29-dione (PubChem CID 123431044) has the molecular formula C27H37N7O3 and a molecular weight of 507.64 g/mol. Its IUPAC name is 7-methoxy-10,18-dimethyl-3,10,18,22,24,26,28-heptazatetracyclo[21.6.1.14,8.027,30]hentriaconta-2,4(31),5,7,23(30),24,26-heptaene-17,29-dione.
| Compound Name | 7-methoxy-10,18-dimethyl-3,10,18,22,24,26,28-heptazatetracyclo[21.6.1.14,8.027,30]hentriaconta-2,4(31),5,7,23(30),24,26-heptaene-17,29-dione |
|---|---|
| PubChem CID | 123431044 |
| Molecular Formula | C27H37N7O3 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 7-methoxy-10,18-dimethyl-3,10,18,22,24,26,28-heptazatetracyclo[21.6.1.14,8.027,30]hentriaconta-2,4(31),5,7,23(30),24,26-heptaene-17,29-dione |
| SMILES | COc1ccc2cc1CN(C)CCCCCCC(=O)N(C)CCCNc1ncnc3c1C(/C=N\2)C(=O)N3 |
| InChI | InChI=1S/C27H37N7O3/c1-33-13-7-5-4-6-9-23(35)34(2)14-8-12-28-25-24-21(27(36)32-26(24)31-18-30-25)16-29-20-10-11-22(37-3)19(15-20)17-33/h10-11,15-16,18,21H,4-9,12-14,17H2,1-3H3,(H2,28,30,31,32,36)/b29-16- |
| InChIKey | MJLSQWGPZZMVSF-MWLSYYOVSA-N |
| XLogP | 3.58 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |