C28H39N9O2 — CID 135903148
26-hydroxy-9,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,9,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-1(26),2,4(28),5,7,20,22,24(27)-octaen-14-one (PubChem CID 135903148) has the molecular formula C28H39N9O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 26-hydroxy-9,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,9,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-1(26),2,4(28),5,7,20,22,24(27)-octaen-14-one.
| Compound Name | 26-hydroxy-9,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,9,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-1(26),2,4(28),5,7,20,22,24(27)-octaen-14-one |
|---|---|
| PubChem CID | 135903148 |
| Molecular Formula | C28H39N9O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | 26-hydroxy-9,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,9,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-1(26),2,4(28),5,7,20,22,24(27)-octaen-14-one |
| SMILES | CN1CCN(c2ccc3cc2N(C)CCCCC(=O)N(C)CCCNc2ncnc4[nH]c(O)c(c24)/C=N\3)CC1 |
| InChI | InChI=1S/C28H39N9O2/c1-34-13-15-37(16-14-34)22-9-8-20-17-23(22)35(2)11-5-4-7-24(38)36(3)12-6-10-29-26-25-21(18-30-20)28(39)33-27(25)32-19-31-26/h8-9,17-19,39H,4-7,10-16H2,1-3H3,(H2,29,31,32,33)/b30-18- |
| InChIKey | PNZPJKBKUHBEPX-YKQZZPSBSA-N |
| XLogP | 3.05 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|