C28H39N9O2 — CID 123354662
10,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-2,4(28),5,7,20(27),21,23-heptaene-14,26-dione (PubChem CID 123354662) has the molecular formula C28H39N9O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 10,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-2,4(28),5,7,20(27),21,23-heptaene-14,26-dione.
| Compound Name | 10,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-2,4(28),5,7,20(27),21,23-heptaene-14,26-dione |
|---|---|
| PubChem CID | 123354662 |
| Molecular Formula | C28H39N9O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | 10,15-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,15,19,21,23,25-heptazatetracyclo[18.6.1.14,8.024,27]octacosa-2,4(28),5,7,20(27),21,23-heptaene-14,26-dione |
| SMILES | CN1CCN(c2ccc3cc2CN(C)CCCC(=O)N(C)CCCNc2ncnc4c2C(/C=N\3)C(=O)N4)CC1 |
| InChI | InChI=1S/C28H39N9O2/c1-34-12-14-37(15-13-34)23-8-7-21-16-20(23)18-35(2)10-4-6-24(38)36(3)11-5-9-29-26-25-22(17-30-21)28(39)33-27(25)32-19-31-26/h7-8,16-17,19,22H,4-6,9-15,18H2,1-3H3,(H2,29,31,32,33,39)/b30-17- |
| InChIKey | HBLLMJHKBOFEKG-LQNQUEJISA-N |
| XLogP | 2.15 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|