C30H43N9O2 — CID 123298992
10,17-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-16,28-dione (PubChem CID 123298992) has the molecular formula C30H43N9O2 and a molecular weight of 561.74 g/mol. Its IUPAC name is 10,17-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-16,28-dione.
| Compound Name | 10,17-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-16,28-dione |
|---|---|
| PubChem CID | 123298992 |
| Molecular Formula | C30H43N9O2 |
| Molecular Weight | 561.74 g/mol |
| Exact Mass | 561.35 |
| IUPAC Name | 10,17-dimethyl-7-(4-methylpiperazin-1-yl)-3,10,17,21,23,25,27-heptazatetracyclo[20.6.1.14,8.026,29]triaconta-2,4(30),5,7,22(29),23,25-heptaene-16,28-dione |
| SMILES | CN1CCN(c2ccc3cc2CN(C)CCCCCC(=O)N(C)CCCNc2ncnc4c2C(/C=N/3)C(=O)N4)CC1 |
| InChI | InChI=1S/C30H43N9O2/c1-36-14-16-39(17-15-36)25-10-9-23-18-22(25)20-37(2)12-6-4-5-8-26(40)38(3)13-7-11-31-28-27-24(19-32-23)30(41)35-29(27)34-21-33-28/h9-10,18-19,21,24H,4-8,11-17,20H2,1-3H3,(H2,31,33,34,35,41)/b32-19+ |
| InChIKey | VLJPZQCNKCSDSM-BIZUNTBRSA-N |
| XLogP | 2.93 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|