C21H25ClN6O2 — CID 59442372
6-chloro-11,15,19-trimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(24),3(25),4,6,17,20,22-heptaen-10-one (PubChem CID 59442372) has the molecular formula C21H25ClN6O2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 6-chloro-11,15,19-trimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(24),3(25),4,6,17,20,22-heptaen-10-one.
| Compound Name | 6-chloro-11,15,19-trimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(24),3(25),4,6,17,20,22-heptaen-10-one |
|---|---|
| PubChem CID | 59442372 |
| Molecular Formula | C21H25ClN6O2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 6-chloro-11,15,19-trimethyl-8-oxa-2,11,15,19,21,23-hexazatetracyclo[15.6.1.13,7.020,24]pentacosa-1(24),3(25),4,6,17,20,22-heptaen-10-one |
| SMILES | CN1CCCN(C)C(=O)COc2cc(ccc2Cl)Nc2ncnc3c2c(cn3C)C1 |
| InChI | InChI=1S/C21H25ClN6O2/c1-26-7-4-8-27(2)18(29)12-30-17-9-15(5-6-16(17)22)25-20-19-14(10-26)11-28(3)21(19)24-13-23-20/h5-6,9,11,13H,4,7-8,10,12H2,1-3H3,(H,23,24,25) |
| InChIKey | JGJXGRRIUQRATP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |