C20H16N2O7S — CID 135903704
methyl (5E)-4-hydroxy-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-(3-nitrophenyl)iminothiophene-3-carboxylate (PubChem CID 135903704) has the molecular formula C20H16N2O7S and a molecular weight of 428.42 g/mol. Its IUPAC name is methyl (5E)-4-hydroxy-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-(3-nitrophenyl)iminothiophene-3-carboxylate.
| Compound Name | methyl (5E)-4-hydroxy-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-(3-nitrophenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135903704 |
| Molecular Formula | C20H16N2O7S |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | methyl (5E)-4-hydroxy-5-[(3-hydroxy-4-methoxyphenyl)methylidene]-2-(3-nitrophenyl)iminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C\c2ccc(OC)c(O)c2)S/C1=N\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N2O7S/c1-28-15-7-6-11(8-14(15)23)9-16-18(24)17(20(25)29-2)19(30-16)21-12-4-3-5-13(10-12)22(26)27/h3-10,23-24H,1-2H3/b16-9+,21-19- |
| InChIKey | HGCAUBVJTLICFN-RMMZIZBISA-N |
| XLogP | 4.11 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|