C20H14N2O7S — CID 135940060
methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-(3-nitrophenyl)iminothiophene-3-carboxylate (PubChem CID 135940060) has the molecular formula C20H14N2O7S and a molecular weight of 426.41 g/mol. Its IUPAC name is methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-(3-nitrophenyl)iminothiophene-3-carboxylate.
| Compound Name | methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-(3-nitrophenyl)iminothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135940060 |
| Molecular Formula | C20H14N2O7S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | methyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-hydroxy-2-(3-nitrophenyl)iminothiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)/C(=C\c2ccc3c(c2)OCO3)S/C1=N\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14N2O7S/c1-27-20(24)17-18(23)16(8-11-5-6-14-15(7-11)29-10-28-14)30-19(17)21-12-3-2-4-13(9-12)22(25)26/h2-9,23H,10H2,1H3/b16-8+,21-19- |
| InChIKey | RCMFXSAZIGWMGB-NHWLLTSQSA-N |
| XLogP | 4.13 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|