C21H16FNO5S — CID 135940342
ethyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 135940342) has the molecular formula C21H16FNO5S and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 135940342 |
| Molecular Formula | C21H16FNO5S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | ethyl (5E)-5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-fluorophenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(O)/C(=C\c2ccc3c(c2)OCO3)S/C1=N\c1cccc(F)c1 |
| InChI | InChI=1S/C21H16FNO5S/c1-2-26-21(25)18-19(24)17(9-12-6-7-15-16(8-12)28-11-27-15)29-20(18)23-14-5-3-4-13(22)10-14/h3-10,24H,2,11H2,1H3/b17-9+,23-20- |
| InChIKey | HPHHKFJQYQVUSO-FGVPMPITSA-N |
| XLogP | 4.75 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|