C20H14ClNO5S — CID 171136389
methyl 5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-chlorophenyl)imino-4-hydroxythiophene-3-carboxylate (PubChem CID 171136389) has the molecular formula C20H14ClNO5S and a molecular weight of 415.85 g/mol. Its IUPAC name is methyl 5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-chlorophenyl)imino-4-hydroxythiophene-3-carboxylate.
| Compound Name | methyl 5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-chlorophenyl)imino-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 171136389 |
| Molecular Formula | C20H14ClNO5S |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | methyl 5-(1,3-benzodioxol-5-ylmethylidene)-2-(3-chlorophenyl)imino-4-hydroxythiophene-3-carboxylate |
| SMILES | COC(=O)C1=C(O)C(=Cc2ccc3c(c2)OCO3)S/C1=N\c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H14ClNO5S/c1-25-20(24)17-18(23)16(8-11-5-6-14-15(7-11)27-10-26-14)28-19(17)22-13-4-2-3-12(21)9-13/h2-9,23H,10H2,1H3/b16-8?,22-19- |
| InChIKey | KZHWETZZJHLIBG-ATZWZZCKSA-N |
| XLogP | 4.87 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|