C25H31NO — CID 135908468
2-[[(1R)-1-phenylethyl]iminomethyl]-6-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol (PubChem CID 135908468) has the molecular formula C25H31NO and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[[(1R)-1-phenylethyl]iminomethyl]-6-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol.
| Compound Name | 2-[[(1R)-1-phenylethyl]iminomethyl]-6-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol |
|---|---|
| PubChem CID | 135908468 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[[(1R)-1-phenylethyl]iminomethyl]-6-[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol |
| SMILES | C[C@@H](/N=C/c1cccc([C@H]2C[C@@H]3CC[C@@]2(C)C3(C)C)c1O)c1ccccc1 |
| InChI | InChI=1S/C25H31NO/c1-17(18-9-6-5-7-10-18)26-16-19-11-8-12-21(23(19)27)22-15-20-13-14-25(22,4)24(20,2)3/h5-12,16-17,20,22,27H,13-15H2,1-4H3/b26-16+/t17-,20+,22-,25-/m1/s1 |
| InChIKey | SYLDMVZJYLUYCY-ACJQLZBESA-N |
| XLogP | 6.50 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|