C35H47NO — CID 137175881
4-[[(1R)-1-phenylethyl]iminomethyl]-2,6-bis[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol (PubChem CID 137175881) has the molecular formula C35H47NO and a molecular weight of 497.77 g/mol. Its IUPAC name is 4-[[(1R)-1-phenylethyl]iminomethyl]-2,6-bis[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol.
| Compound Name | 4-[[(1R)-1-phenylethyl]iminomethyl]-2,6-bis[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol |
|---|---|
| PubChem CID | 137175881 |
| Molecular Formula | C35H47NO |
| Molecular Weight | 497.77 g/mol |
| Exact Mass | 497.37 |
| IUPAC Name | 4-[[(1R)-1-phenylethyl]iminomethyl]-2,6-bis[(1R,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]phenol |
| SMILES | C[C@@H](/N=C/c1cc([C@H]2C[C@@H]3CC[C@@]2(C)C3(C)C)c(O)c([C@H]2C[C@@H]3CC[C@@]2(C)C3(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C35H47NO/c1-22(24-11-9-8-10-12-24)36-21-23-17-27(29-19-25-13-15-34(29,6)32(25,2)3)31(37)28(18-23)30-20-26-14-16-35(30,7)33(26,4)5/h8-12,17-18,21-22,25-26,29-30,37H,13-16,19-20H2,1-7H3/b36-21+/t22-,25+,26+,29-,30-,34-,35-/m1/s1 |
| InChIKey | PUXYAAWRIUUEST-JEGKFCEBSA-N |
| XLogP | 9.43 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|