C30H33NO — CID 101415698
[(1R,4R)-7,7-dimethyl-2-[(1R)-1-phenylethyl]imino-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol (PubChem CID 101415698) has the molecular formula C30H33NO and a molecular weight of 423.60 g/mol. Its IUPAC name is [(1R,4R)-7,7-dimethyl-2-[(1R)-1-phenylethyl]imino-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol.
| Compound Name | [(1R,4R)-7,7-dimethyl-2-[(1R)-1-phenylethyl]imino-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol |
|---|---|
| PubChem CID | 101415698 |
| Molecular Formula | C30H33NO |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | [(1R,4R)-7,7-dimethyl-2-[(1R)-1-phenylethyl]imino-1-bicyclo[2.2.1]heptanyl]-diphenylmethanol |
| SMILES | C[C@@H](/N=C1\C[C@H]2CC[C@@]1(C(O)(c1ccccc1)c1ccccc1)C2(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H33NO/c1-22(23-13-7-4-8-14-23)31-27-21-26-19-20-29(27,28(26,2)3)30(32,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h4-18,22,26,32H,19-21H2,1-3H3/b31-27+/t22-,26-,29+/m1/s1 |
| InChIKey | HLYJWDKIMBGTDR-OUAWBXPZSA-N |
| XLogP | 6.95 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|