C17H23NO — CID 10244209
[(1S,4R)-2-benzylimino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanol (PubChem CID 10244209) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is [(1S,4R)-2-benzylimino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanol.
| Compound Name | [(1S,4R)-2-benzylimino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanol |
|---|---|
| PubChem CID | 10244209 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | [(1S,4R)-2-benzylimino-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CO)/C(=N/Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H23NO/c1-16(2)14-8-9-17(16,12-19)15(10-14)18-11-13-6-4-3-5-7-13/h3-7,14,19H,8-12H2,1-2H3/b18-15+/t14-,17-/m1/s1 |
| InChIKey | OSVQRGXMOJRNDF-STPQTROMSA-N |
| XLogP | 3.45 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|