C19H19BrN4O6 — CID 135910898
N'-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(4-methyl-2-nitrophenyl)butanediamide (PubChem CID 135910898) has the molecular formula C19H19BrN4O6 and a molecular weight of 479.29 g/mol. Its IUPAC name is N'-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(4-methyl-2-nitrophenyl)butanediamide.
| Compound Name | N'-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(4-methyl-2-nitrophenyl)butanediamide |
|---|---|
| PubChem CID | 135910898 |
| Molecular Formula | C19H19BrN4O6 |
| Molecular Weight | 479.29 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N'-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-N-(4-methyl-2-nitrophenyl)butanediamide |
| SMILES | COc1cc(/C=N\NC(=O)CCC(=O)Nc2ccc(C)cc2[N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C19H19BrN4O6/c1-11-3-4-14(15(7-11)24(28)29)22-17(25)5-6-18(26)23-21-10-12-8-13(20)19(27)16(9-12)30-2/h3-4,7-10,27H,5-6H2,1-2H3,(H,22,25)(H,23,26)/b21-10- |
| InChIKey | HTWDYDCRGXJUNU-FBHDLOMBSA-N |
| XLogP | 3.25 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|