C16H16F3N3O4 — CID 135918327
6-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135918327) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is 6-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135918327 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-[(3,4-dihydroxy-5-methoxyphenyl)methyl]-2-(trifluoromethyl)-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cc(CN2CCc3nc(C(F)(F)F)[nH]c(=O)c3C2)cc(O)c1O |
| InChI | InChI=1S/C16H16F3N3O4/c1-26-12-5-8(4-11(23)13(12)24)6-22-3-2-10-9(7-22)14(25)21-15(20-10)16(17,18)19/h4-5,23-24H,2-3,6-7H2,1H3,(H,20,21,25) |
| InChIKey | BHPSPWIBYVGAGE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|