C22H31N3O3 — CID 135924644
2-cyclohexyl-N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)iminoacetamide (PubChem CID 135924644) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-cyclohexyl-N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)iminoacetamide.
| Compound Name | 2-cyclohexyl-N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)iminoacetamide |
|---|---|
| PubChem CID | 135924644 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 2-cyclohexyl-N-(2-hydroxy-6-methoxy-1-pentylindol-3-yl)iminoacetamide |
| SMILES | CCCCCn1c(O)c(/N=N/C(=O)CC2CCCCC2)c2ccc(OC)cc21 |
| InChI | InChI=1S/C22H31N3O3/c1-3-4-8-13-25-19-15-17(28-2)11-12-18(19)21(22(25)27)24-23-20(26)14-16-9-6-5-7-10-16/h11-12,15-16,27H,3-10,13-14H2,1-2H3/b24-23+ |
| InChIKey | ACWHUTDXOPLWMG-WCWDXBQESA-N |
| XLogP | 6.13 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|