C21H20Br2N4OS — CID 135926453
(2Z)-2-[(Z)-[2,6-bis(4-bromophenyl)-3-methylpiperidin-4-ylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135926453) has the molecular formula C21H20Br2N4OS and a molecular weight of 536.29 g/mol. Its IUPAC name is (2Z)-2-[(Z)-[2,6-bis(4-bromophenyl)-3-methylpiperidin-4-ylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(Z)-[2,6-bis(4-bromophenyl)-3-methylpiperidin-4-ylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135926453 |
| Molecular Formula | C21H20Br2N4OS |
| Molecular Weight | 536.29 g/mol |
| Exact Mass | 533.97 |
| IUPAC Name | (2Z)-2-[(Z)-[2,6-bis(4-bromophenyl)-3-methylpiperidin-4-ylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1/C(=N\N=C2\NC(=O)CS2)CC(c2ccc(Br)cc2)NC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H20Br2N4OS/c1-12-17(26-27-21-25-19(28)11-29-21)10-18(13-2-6-15(22)7-3-13)24-20(12)14-4-8-16(23)9-5-14/h2-9,12,18,20,24H,10-11H2,1H3,(H,25,27,28)/b26-17- |
| InChIKey | NSQOFVFFQAWIFP-ONUIUJJFSA-N |
| XLogP | 5.20 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.29 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|