C19H16BrN3OS — CID 135927980
8-bromo-2-[(2-phenylethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 135927980) has the molecular formula C19H16BrN3OS and a molecular weight of 414.33 g/mol. Its IUPAC name is 8-bromo-2-[(2-phenylethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 8-bromo-2-[(2-phenylethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135927980 |
| Molecular Formula | C19H16BrN3OS |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 8-bromo-2-[(2-phenylethylamino)methyl]-3H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CNCCc2ccccc2)nc2c1sc1ccc(Br)cc12 |
| InChI | InChI=1S/C19H16BrN3OS/c20-13-6-7-15-14(10-13)17-18(25-15)19(24)23-16(22-17)11-21-9-8-12-4-2-1-3-5-12/h1-7,10,21H,8-9,11H2,(H,22,23,24) |
| InChIKey | GQYGJJRBTBCMJJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|