C21H28N4O3 — CID 135928644
2-[[oxolan-2-ylmethyl-(2-oxo-2-piperidin-1-ylethyl)amino]methyl]-3H-quinazolin-4-one (PubChem CID 135928644) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[[oxolan-2-ylmethyl-(2-oxo-2-piperidin-1-ylethyl)amino]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[oxolan-2-ylmethyl-(2-oxo-2-piperidin-1-ylethyl)amino]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135928644 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-[[oxolan-2-ylmethyl-(2-oxo-2-piperidin-1-ylethyl)amino]methyl]-3H-quinazolin-4-one |
| SMILES | O=C(CN(Cc1nc2ccccc2c(=O)[nH]1)CC1CCCO1)N1CCCCC1 |
| InChI | InChI=1S/C21H28N4O3/c26-20(25-10-4-1-5-11-25)15-24(13-16-7-6-12-28-16)14-19-22-18-9-3-2-8-17(18)21(27)23-19/h2-3,8-9,16H,1,4-7,10-15H2,(H,22,23,27) |
| InChIKey | BCXANAQRYLTDRJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |