C19H25N5O5 — CID 135931789
ethyl 3-[2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoate (PubChem CID 135931789) has the molecular formula C19H25N5O5 and a molecular weight of 403.44 g/mol. Its IUPAC name is ethyl 3-[2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoate.
| Compound Name | ethyl 3-[2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoate |
|---|---|
| PubChem CID | 135931789 |
| Molecular Formula | C19H25N5O5 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | ethyl 3-[2-[[amino-(2,5-dimethoxyanilino)methylidene]amino]-4-methyl-6-oxo-1H-pyrimidin-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1c(C)nc(N=C(N)Nc2cc(OC)ccc2OC)[nH]c1=O |
| InChI | InChI=1S/C19H25N5O5/c1-5-29-16(25)9-7-13-11(2)21-19(23-17(13)26)24-18(20)22-14-10-12(27-3)6-8-15(14)28-4/h6,8,10H,5,7,9H2,1-4H3,(H4,20,21,22,23,24,26) |
| InChIKey | AQRJATZOZGDWFU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 140.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|