C19H22BrN3O5S — CID 135934026
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide (PubChem CID 135934026) has the molecular formula C19H22BrN3O5S and a molecular weight of 484.37 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 135934026 |
| Molecular Formula | C19H22BrN3O5S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-(2,6-dimethyl-N-methylsulfonylanilino)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2c(C)cccc2C)S(C)(=O)=O)cc(Br)c1O |
| InChI | InChI=1S/C19H22BrN3O5S/c1-12-6-5-7-13(2)18(12)23(29(4,26)27)11-17(24)22-21-10-14-8-15(20)19(25)16(9-14)28-3/h5-10,25H,11H2,1-4H3,(H,22,24)/b21-10- |
| InChIKey | QQHBNYLRUUTXOM-FBHDLOMBSA-N |
| XLogP | 2.70 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|