C18H17BrF3N3O5S — CID 137118985
N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide (PubChem CID 137118985) has the molecular formula C18H17BrF3N3O5S and a molecular weight of 524.32 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 137118985 |
| Molecular Formula | C18H17BrF3N3O5S |
| Molecular Weight | 524.32 g/mol |
| Exact Mass | 523.00 |
| IUPAC Name | N-[(Z)-(3-bromo-4-hydroxy-5-methoxyphenyl)methylideneamino]-2-[N-methylsulfonyl-3-(trifluoromethyl)anilino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2cccc(C(F)(F)F)c2)S(C)(=O)=O)cc(Br)c1O |
| InChI | InChI=1S/C18H17BrF3N3O5S/c1-30-15-7-11(6-14(19)17(15)27)9-23-24-16(26)10-25(31(2,28)29)13-5-3-4-12(8-13)18(20,21)22/h3-9,27H,10H2,1-2H3,(H,24,26)/b23-9- |
| InChIKey | NHCLBORYXCZJHY-AQHIEDMUSA-N |
| XLogP | 3.10 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|