C14H12N4O2S — CID 135938483
2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-N-pyridin-2-yl-2-sulfanylideneacetamide (PubChem CID 135938483) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-N-pyridin-2-yl-2-sulfanylideneacetamide.
| Compound Name | 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-N-pyridin-2-yl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 135938483 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(2E)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]-N-pyridin-2-yl-2-sulfanylideneacetamide |
| SMILES | O=C(Nc1ccccn1)C(=S)N/N=C/c1ccccc1O |
| InChI | InChI=1S/C14H12N4O2S/c19-11-6-2-1-5-10(11)9-16-18-14(21)13(20)17-12-7-3-4-8-15-12/h1-9,19H,(H,18,21)(H,15,17,20)/b16-9+ |
| InChIKey | XGEKVHKDEXQVFT-CXUHLZMHSA-N |
| XLogP | 1.68 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|