C18H20ClN5O2 — CID 135942024
4-amino-N-[2-[(4-phenylphenyl)methylamino]ethyl]-1,2,5-oxadiazol-5-ium-3-carboxamide chloride (PubChem CID 135942024) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is 4-amino-N-[2-[(4-phenylphenyl)methylamino]ethyl]-1,2,5-oxadiazol-5-ium-3-carboxamide chloride.
| Compound Name | 4-amino-N-[2-[(4-phenylphenyl)methylamino]ethyl]-1,2,5-oxadiazol-5-ium-3-carboxamide chloride |
|---|---|
| PubChem CID | 135942024 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-amino-N-[2-[(4-phenylphenyl)methylamino]ethyl]-1,2,5-oxadiazol-5-ium-3-carboxamide chloride |
| SMILES | Nc1[nH+]onc1C(=O)NCCNCc1ccc(-c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C18H19N5O2.ClH/c19-17-16(22-25-23-17)18(24)21-11-10-20-12-13-6-8-15(9-7-13)14-4-2-1-3-5-14;/h1-9,20H,10-12H2,(H2,19,23)(H,21,24);1H |
| InChIKey | QSIJBBSOOPLNBI-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|