C18H15FN4O7S — CID 135944509
6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135944509) has the molecular formula C18H15FN4O7S and a molecular weight of 450.40 g/mol. Its IUPAC name is 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135944509 |
| Molecular Formula | C18H15FN4O7S |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 6-[(6-fluoro-8-nitro-4-oxochromen-3-yl)methyl]-2-methylsulfonyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CS(=O)(=O)c1nc2c(c(=O)[nH]1)CN(Cc1coc3c([N+](=O)[O-])cc(F)cc3c1=O)CC2 |
| InChI | InChI=1S/C18H15FN4O7S/c1-31(28,29)18-20-13-2-3-22(7-12(13)17(25)21-18)6-9-8-30-16-11(15(9)24)4-10(19)5-14(16)23(26)27/h4-5,8H,2-3,6-7H2,1H3,(H,20,21,25) |
| InChIKey | JLICUPXMXUMWGE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 156.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|