C26H32N2O4 — CID 135950334
2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-(5-piperidin-1-ylpentoxy)phenol (PubChem CID 135950334) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-(5-piperidin-1-ylpentoxy)phenol.
| Compound Name | 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-(5-piperidin-1-ylpentoxy)phenol |
|---|---|
| PubChem CID | 135950334 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-1,2-oxazol-5-yl]-5-(5-piperidin-1-ylpentoxy)phenol |
| SMILES | COc1ccc(-c2cnoc2-c2ccc(OCCCCCN3CCCCC3)cc2O)cc1 |
| InChI | InChI=1S/C26H32N2O4/c1-30-21-10-8-20(9-11-21)24-19-27-32-26(24)23-13-12-22(18-25(23)29)31-17-7-3-6-16-28-14-4-2-5-15-28/h8-13,18-19,29H,2-7,14-17H2,1H3 |
| InChIKey | SBUUWJIYPBUNHN-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|