C22H23NO6 — CID 141398778
2-[2-hydroxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-6-methoxy-1-benzofuran-3-carboxylic acid (PubChem CID 141398778) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[2-hydroxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-6-methoxy-1-benzofuran-3-carboxylic acid.
| Compound Name | 2-[2-hydroxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-6-methoxy-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 141398778 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[2-hydroxy-4-(2-pyrrolidin-1-ylethoxy)phenyl]-6-methoxy-1-benzofuran-3-carboxylic acid |
| SMILES | COc1ccc2c(C(=O)O)c(-c3ccc(OCCN4CCCC4)cc3O)oc2c1 |
| InChI | InChI=1S/C22H23NO6/c1-27-14-4-7-17-19(13-14)29-21(20(17)22(25)26)16-6-5-15(12-18(16)24)28-11-10-23-8-2-3-9-23/h4-7,12-13,24H,2-3,8-11H2,1H3,(H,25,26) |
| InChIKey | YENYANDRTKMTMJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |