C22H29N3O3S — CID 135951920
N-[(E)-[(2Z)-2-hydroxyimino-1-(4-propan-2-ylphenyl)hexylidene]amino]-4-methylbenzenesulfonamide (PubChem CID 135951920) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[(E)-[(2Z)-2-hydroxyimino-1-(4-propan-2-ylphenyl)hexylidene]amino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-[(2Z)-2-hydroxyimino-1-(4-propan-2-ylphenyl)hexylidene]amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135951920 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[(E)-[(2Z)-2-hydroxyimino-1-(4-propan-2-ylphenyl)hexylidene]amino]-4-methylbenzenesulfonamide |
| SMILES | CCCCC(=N/O)/C(=N/NS(=O)(=O)c1ccc(C)cc1)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H29N3O3S/c1-5-6-7-21(24-26)22(19-12-10-18(11-13-19)16(2)3)23-25-29(27,28)20-14-8-17(4)9-15-20/h8-16,25-26H,5-7H2,1-4H3/b23-22+,24-21- |
| InChIKey | XLEHTQAWRCBJOI-IKXBEZASSA-N |
| XLogP | 4.82 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|