C13H17N4O2U- — CID 135966731
9-[(2R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-1,8-dihydropurin-8-id-6-one;uranium (PubChem CID 135966731) has the molecular formula C13H17N4O2U- and a molecular weight of 499.33 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-1,8-dihydropurin-8-id-6-one;uranium.
| Compound Name | 9-[(2R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-1,8-dihydropurin-8-id-6-one;uranium |
|---|---|
| PubChem CID | 135966731 |
| Molecular Formula | C13H17N4O2U- |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 9-[(2R,4S,5R)-5-ethyl-3,4-dimethyloxolan-2-yl]-1,8-dihydropurin-8-id-6-one;uranium |
| SMILES | CC[C@H]1O[C@@H](n2[c-]nc3c(=O)[nH]cnc32)C(C)[C@@H]1C.[U] |
| InChI | InChI=1S/C13H17N4O2.U/c1-4-9-7(2)8(3)13(19-9)17-6-16-10-11(17)14-5-15-12(10)18;/h5,7-9,13H,4H2,1-3H3,(H,14,15,18);/q-1;/t7-,8?,9+,13+;/m0./s1 |
| InChIKey | WJOHZCQWQRUJLA-UBCCROPJSA-N |
| XLogP | 1.50 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|