C18H28N4O3 — CID 176863790
9-[(2R,4S,5R)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione (PubChem CID 176863790) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione.
| Compound Name | 9-[(2R,4S,5R)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 176863790 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 9-[(2R,4S,5R)-4-tert-butyl-5-(2,2-dimethylpropyl)oxolan-2-yl]-1,7-dihydropurine-6,8-dione |
| SMILES | CC(C)(C)C[C@H]1O[C@@H](n2c(=O)[nH]c3c(=O)[nH]cnc32)C[C@H]1C(C)(C)C |
| InChI | InChI=1S/C18H28N4O3/c1-17(2,3)8-11-10(18(4,5)6)7-12(25-11)22-14-13(21-16(22)24)15(23)20-9-19-14/h9-12H,7-8H2,1-6H3,(H,21,24)(H,19,20,23)/t10-,11-,12-/m1/s1 |
| InChIKey | FQTHIOMUDXUEJL-IJLUTSLNSA-N |
| XLogP | 2.80 |
| TPSA | 92.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |