C15H22N5O2Tl — CID 144654211
ethane;[[9-(5-ethyl-3-ethynyloxolan-2-yl)-6-oxo-7,8-dihydro-1H-purin-2-yl]amino]thallium (PubChem CID 144654211) has the molecular formula C15H22N5O2Tl and a molecular weight of 508.76 g/mol. Its IUPAC name is ethane;[[9-(5-ethyl-3-ethynyloxolan-2-yl)-6-oxo-7,8-dihydro-1H-purin-2-yl]amino]thallium.
| Compound Name | ethane;[[9-(5-ethyl-3-ethynyloxolan-2-yl)-6-oxo-7,8-dihydro-1H-purin-2-yl]amino]thallium |
|---|---|
| PubChem CID | 144654211 |
| Molecular Formula | C15H22N5O2Tl |
| Molecular Weight | 508.76 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | ethane;[[9-(5-ethyl-3-ethynyloxolan-2-yl)-6-oxo-7,8-dihydro-1H-purin-2-yl]amino]thallium |
| SMILES | C#CC1CC(CC)OC1N1CNc2c1nc(N[Tl])[nH]c2=O.CC |
| InChI | InChI=1S/C13H17N5O2.C2H6.Tl/c1-3-7-5-8(4-2)20-12(7)18-6-15-9-10(18)16-13(14)17-11(9)19;1-2;/h1,7-8,12,15H,4-6H2,2H3,(H3,14,16,17,19);1-2H3;/q;;+1/p-1 |
| InChIKey | XJZQZLZEAAXEFD-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.76 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|