C16H21N3O2 — CID 135978681
4-(4-amino-6-tert-butylpyrimidin-2-yl)-2-ethoxyphenol (PubChem CID 135978681) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(4-amino-6-tert-butylpyrimidin-2-yl)-2-ethoxyphenol.
| Compound Name | 4-(4-amino-6-tert-butylpyrimidin-2-yl)-2-ethoxyphenol |
|---|---|
| PubChem CID | 135978681 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-(4-amino-6-tert-butylpyrimidin-2-yl)-2-ethoxyphenol |
| SMILES | CCOc1cc(-c2nc(N)cc(C(C)(C)C)n2)ccc1O |
| InChI | InChI=1S/C16H21N3O2/c1-5-21-12-8-10(6-7-11(12)20)15-18-13(16(2,3)4)9-14(17)19-15/h6-9,20H,5H2,1-4H3,(H2,17,18,19) |
| InChIKey | YYCSALKCZRBGEV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |