C15H14N8O2S2 — CID 135979397
5-[(E)-[4-(methylamino)-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile (PubChem CID 135979397) has the molecular formula C15H14N8O2S2 and a molecular weight of 402.47 g/mol. Its IUPAC name is 5-[(E)-[4-(methylamino)-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile.
| Compound Name | 5-[(E)-[4-(methylamino)-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 135979397 |
| Molecular Formula | C15H14N8O2S2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 5-[(E)-[4-(methylamino)-2-(methylsulfonylmethyl)-1,3-thiazol-5-yl]diazenyl]-1-pyridin-2-ylpyrazole-4-carbonitrile |
| SMILES | CNc1nc(CS(C)(=O)=O)sc1/N=N/c1c(C#N)cnn1-c1ccccn1 |
| InChI | InChI=1S/C15H14N8O2S2/c1-17-13-15(26-12(20-13)9-27(2,24)25)22-21-14-10(7-16)8-19-23(14)11-5-3-4-6-18-11/h3-6,8,17H,9H2,1-2H3/b22-21+ |
| InChIKey | GKBLOIHJOOBLBH-QURGRASLSA-N |
| XLogP | 2.60 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|