C17H13N6O3S — CID 135981027
CID 135981027 (PubChem CID 135981027) has the molecular formula C17H13N6O3S and a molecular weight of 381.40 g/mol.
| Compound Name | CID 135981027 |
|---|---|
| PubChem CID | 135981027 |
| Molecular Formula | C17H13N6O3S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | — |
| SMILES | [NH]S(=O)(=O)c1ccc(/N=N/c2c(O)[nH]c3cccc(-c4ccn[nH]4)c23)cc1 |
| InChI | InChI=1S/C17H13N6O3S/c18-27(25,26)11-6-4-10(5-7-11)21-23-16-15-12(13-8-9-19-22-13)2-1-3-14(15)20-17(16)24/h1-9,18,20,24H,(H,19,22)/b23-21+ |
| InChIKey | NBWUJXNQZQURHL-XTQSDGFTSA-N |
| XLogP | 3.65 |
| TPSA | 147.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|