C17H16N4S3 — CID 135984128
4-[3-[(4-amino-6-methylsulfanylpyrimidin-2-yl)sulfanylmethyl]-2-pyridinyl]benzenethiol (PubChem CID 135984128) has the molecular formula C17H16N4S3 and a molecular weight of 372.54 g/mol. Its IUPAC name is 4-[3-[(4-amino-6-methylsulfanylpyrimidin-2-yl)sulfanylmethyl]-2-pyridinyl]benzenethiol.
| Compound Name | 4-[3-[(4-amino-6-methylsulfanylpyrimidin-2-yl)sulfanylmethyl]-2-pyridinyl]benzenethiol |
|---|---|
| PubChem CID | 135984128 |
| Molecular Formula | C17H16N4S3 |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-[3-[(4-amino-6-methylsulfanylpyrimidin-2-yl)sulfanylmethyl]-2-pyridinyl]benzenethiol |
| SMILES | CSc1cc(N)nc(SCc2cccnc2-c2ccc(S)cc2)n1 |
| InChI | InChI=1S/C17H16N4S3/c1-23-15-9-14(18)20-17(21-15)24-10-12-3-2-8-19-16(12)11-4-6-13(22)7-5-11/h2-9,22H,10H2,1H3,(H2,18,20,21) |
| InChIKey | OUWPMVKIJCIIBJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|