C12H14N4OS2 — CID 23294000
2-[(3-methoxy-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 23294000) has the molecular formula C12H14N4OS2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-[(3-methoxy-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-[(3-methoxy-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23294000 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-[(3-methoxy-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | COc1cccnc1CSc1nc(N)cc(SC)n1 |
| InChI | InChI=1S/C12H14N4OS2/c1-17-9-4-3-5-14-8(9)7-19-12-15-10(13)6-11(16-12)18-2/h3-6H,7H2,1-2H3,(H2,13,15,16) |
| InChIKey | SVWPMTHEBCVJON-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |