C14H16N4S2 — CID 23293893
2-[(3-cyclopropyl-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 23293893) has the molecular formula C14H16N4S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-[(3-cyclopropyl-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-[(3-cyclopropyl-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 23293893 |
| Molecular Formula | C14H16N4S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[(3-cyclopropyl-2-pyridinyl)methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(N)nc(SCc2ncccc2C2CC2)n1 |
| InChI | InChI=1S/C14H16N4S2/c1-19-13-7-12(15)17-14(18-13)20-8-11-10(9-4-5-9)3-2-6-16-11/h2-3,6-7,9H,4-5,8H2,1H3,(H2,15,17,18) |
| InChIKey | GKEIQROVEQBOOK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |