C15H20N4S2 — CID 54363248
2-[[4-(2-methylpropyl)-2-pyridinyl]methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine (PubChem CID 54363248) has the molecular formula C15H20N4S2 and a molecular weight of 320.49 g/mol. Its IUPAC name is 2-[[4-(2-methylpropyl)-2-pyridinyl]methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine.
| Compound Name | 2-[[4-(2-methylpropyl)-2-pyridinyl]methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 54363248 |
| Molecular Formula | C15H20N4S2 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[[4-(2-methylpropyl)-2-pyridinyl]methylsulfanyl]-6-methylsulfanylpyrimidin-4-amine |
| SMILES | CSc1cc(N)nc(SCc2cc(CC(C)C)ccn2)n1 |
| InChI | InChI=1S/C15H20N4S2/c1-10(2)6-11-4-5-17-12(7-11)9-21-15-18-13(16)8-14(19-15)20-3/h4-5,7-8,10H,6,9H2,1-3H3,(H2,16,18,19) |
| InChIKey | UNYWDGXCGOVVHH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |